C19H21NO4 — CID 101192402
dimethyl 9-methyl-9-azapentacyclo[8.5.0.02,12.03,8.011,13]pentadeca-3,5,7-triene-10,11-dicarboxylate (PubChem CID 101192402) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is dimethyl 9-methyl-9-azapentacyclo[8.5.0.02,12.03,8.011,13]pentadeca-3,5,7-triene-10,11-dicarboxylate.
| Compound Name | dimethyl 9-methyl-9-azapentacyclo[8.5.0.02,12.03,8.011,13]pentadeca-3,5,7-triene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 101192402 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | dimethyl 9-methyl-9-azapentacyclo[8.5.0.02,12.03,8.011,13]pentadeca-3,5,7-triene-10,11-dicarboxylate |
| SMILES | COC(=O)C12C3CCC4C(c5ccccc5N(C)C41C(=O)OC)C32 |
| InChI | InChI=1S/C19H21NO4/c1-20-13-7-5-4-6-10(13)14-11-8-9-12-15(14)18(12,16(21)23-2)19(11,20)17(22)24-3/h4-7,11-12,14-15H,8-9H2,1-3H3 |
| InChIKey | BSZHRWJZEDJUOR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |