C22H16O8 — CID 101464223
dimethyl (1R,2R,11R,12R)-10,13-dioxo-3,20-dioxapentacyclo[10.8.0.02,11.04,9.014,19]icosa-4,6,8,14,16,18-hexaene-1,2-dicarboxylate (PubChem CID 101464223) has the molecular formula C22H16O8 and a molecular weight of 408.36 g/mol. Its IUPAC name is dimethyl (1R,2R,11R,12R)-10,13-dioxo-3,20-dioxapentacyclo[10.8.0.02,11.04,9.014,19]icosa-4,6,8,14,16,18-hexaene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2R,11R,12R)-10,13-dioxo-3,20-dioxapentacyclo[10.8.0.02,11.04,9.014,19]icosa-4,6,8,14,16,18-hexaene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101464223 |
| Molecular Formula | C22H16O8 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | dimethyl (1R,2R,11R,12R)-10,13-dioxo-3,20-dioxapentacyclo[10.8.0.02,11.04,9.014,19]icosa-4,6,8,14,16,18-hexaene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@]12Oc3ccccc3C(=O)[C@@H]1[C@H]1C(=O)c3ccccc3O[C@]12C(=O)OC |
| InChI | InChI=1S/C22H16O8/c1-27-19(25)21-15(17(23)11-7-3-5-9-13(11)29-21)16-18(24)12-8-4-6-10-14(12)30-22(16,21)20(26)28-2/h3-10,15-16H,1-2H3/t15-,16-,21-,22-/m0/s1 |
| InChIKey | ZNFVVLGXUMZFSP-QDGJQWLKSA-N |
| XLogP | 1.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |