C19H20O4 — CID 162778641
methyl (2R)-2-(2-cyclohexylethynyl)-4-oxo-3H-chromene-2-carboxylate (PubChem CID 162778641) has the molecular formula C19H20O4 and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl (2R)-2-(2-cyclohexylethynyl)-4-oxo-3H-chromene-2-carboxylate.
| Compound Name | methyl (2R)-2-(2-cyclohexylethynyl)-4-oxo-3H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 162778641 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | methyl (2R)-2-(2-cyclohexylethynyl)-4-oxo-3H-chromene-2-carboxylate |
| SMILES | COC(=O)[C@]1(C#CC2CCCCC2)CC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C19H20O4/c1-22-18(21)19(12-11-14-7-3-2-4-8-14)13-16(20)15-9-5-6-10-17(15)23-19/h5-6,9-10,14H,2-4,7-8,13H2,1H3/t19-/m0/s1 |
| InChIKey | RNXWFMOGPXUQFC-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|