C11H11ClO2 — CID 12531632
3-chloro-2,2-dimethyl-3H-chromen-4-one (PubChem CID 12531632) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-3H-chromen-4-one.
| Compound Name | 3-chloro-2,2-dimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 12531632 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3-chloro-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CC1(C)Oc2ccccc2C(=O)C1Cl |
| InChI | InChI=1S/C11H11ClO2/c1-11(2)10(12)9(13)7-5-3-4-6-8(7)14-11/h3-6,10H,1-2H3 |
| InChIKey | ZKJFAHOAIPVHDS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|