C12H11NO2S — CID 81137022
4,4-dimethyl-1H-chromeno[4,3-d][1,3]thiazol-2-one (PubChem CID 81137022) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 4,4-dimethyl-1H-chromeno[4,3-d][1,3]thiazol-2-one.
| Compound Name | 4,4-dimethyl-1H-chromeno[4,3-d][1,3]thiazol-2-one |
|---|---|
| PubChem CID | 81137022 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4,4-dimethyl-1H-chromeno[4,3-d][1,3]thiazol-2-one |
| SMILES | CC1(C)Oc2ccccc2-c2[nH]c(=O)sc21 |
| InChI | InChI=1S/C12H11NO2S/c1-12(2)10-9(13-11(14)16-10)7-5-3-4-6-8(7)15-12/h3-6H,1-2H3,(H,13,14) |
| InChIKey | YOUFDTHGZVNSLU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |