C11H10O2 — CID 140974903
2,2-dimethyloxireno[2,3-c]chromene (PubChem CID 140974903) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2,2-dimethyloxireno[2,3-c]chromene.
| Compound Name | 2,2-dimethyloxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 140974903 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2,2-dimethyloxireno[2,3-c]chromene |
| SMILES | CC1(C)Oc2ccccc2C2=C1O2 |
| InChI | InChI=1S/C11H10O2/c1-11(2)10-9(12-10)7-5-3-4-6-8(7)13-11/h3-6H,1-2H3 |
| InChIKey | LGSZGTPDCMPPSO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |