C14H11Cl2NO4 — CID 11131257
2-[(3R,4R)-3,4-dichloro-5,5-dimethyl-2-oxooxolan-3-yl]isoindole-1,3-dione (PubChem CID 11131257) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is 2-[(3R,4R)-3,4-dichloro-5,5-dimethyl-2-oxooxolan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3R,4R)-3,4-dichloro-5,5-dimethyl-2-oxooxolan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11131257 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[(3R,4R)-3,4-dichloro-5,5-dimethyl-2-oxooxolan-3-yl]isoindole-1,3-dione |
| SMILES | CC1(C)OC(=O)[C@](Cl)(N2C(=O)c3ccccc3C2=O)[C@@H]1Cl |
| InChI | InChI=1S/C14H11Cl2NO4/c1-13(2)11(15)14(16,12(20)21-13)17-9(18)7-5-3-4-6-8(7)10(17)19/h3-6,11H,1-2H3/t11-,14-/m1/s1 |
| InChIKey | GLLXVANKHJHGJS-BXUZGUMPSA-N |
| XLogP | 2.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|