C25H18INO4 — CID 162405696
2-[(3S,4S,5R)-5-(iodomethyl)-2-oxo-3,4-diphenyloxolan-3-yl]isoindole-1,3-dione (PubChem CID 162405696) has the molecular formula C25H18INO4 and a molecular weight of 523.33 g/mol. Its IUPAC name is 2-[(3S,4S,5R)-5-(iodomethyl)-2-oxo-3,4-diphenyloxolan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S,4S,5R)-5-(iodomethyl)-2-oxo-3,4-diphenyloxolan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162405696 |
| Molecular Formula | C25H18INO4 |
| Molecular Weight | 523.33 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | 2-[(3S,4S,5R)-5-(iodomethyl)-2-oxo-3,4-diphenyloxolan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@]1(c2ccccc2)C(=O)O[C@@H](CI)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H18INO4/c26-15-20-21(16-9-3-1-4-10-16)25(24(30)31-20,17-11-5-2-6-12-17)27-22(28)18-13-7-8-14-19(18)23(27)29/h1-14,20-21H,15H2/t20-,21+,25+/m0/s1 |
| InChIKey | MDSOTPXFDPEYID-BPYKYCOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|