C14H11NO4 — CID 162399704
2-[(1R,4R)-3-oxo-2-oxabicyclo[2.2.1]heptan-4-yl]isoindole-1,3-dione (PubChem CID 162399704) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-[(1R,4R)-3-oxo-2-oxabicyclo[2.2.1]heptan-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,4R)-3-oxo-2-oxabicyclo[2.2.1]heptan-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162399704 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[(1R,4R)-3-oxo-2-oxabicyclo[2.2.1]heptan-4-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@]12CC[C@H](C1)OC2=O |
| InChI | InChI=1S/C14H11NO4/c16-11-9-3-1-2-4-10(9)12(17)15(11)14-6-5-8(7-14)19-13(14)18/h1-4,8H,5-7H2/t8-,14-/m1/s1 |
| InChIKey | DRFKCRRAZSFOOH-XLKFXECMSA-N |
| XLogP | 1.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|