C15H13NO6 — CID 11255119
cis-dimethyl (1S,2R)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylate (PubChem CID 11255119) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is cis-dimethyl (1S,2R)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylate.
| Compound Name | cis-dimethyl (1S,2R)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11255119 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | cis-dimethyl (1S,2R)-1-(1,3-dioxoisoindol-2-yl)cyclopropane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]1(C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H13NO6/c1-21-13(19)10-7-15(10,14(20)22-2)16-11(17)8-5-3-4-6-9(8)12(16)18/h3-6,10H,7H2,1-2H3/t10-,15-/m0/s1 |
| InChIKey | CXUMKUALNUDMIX-BONVTDFDSA-N |
| XLogP | 0.39 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|