C21H21NO8 — CID 135025625
2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(Z)-3-ethoxy-3-oxoprop-1-enyl]cyclopropane-1,2-dicarboxylate (PubChem CID 135025625) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is 2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(Z)-3-ethoxy-3-oxoprop-1-enyl]cyclopropane-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(Z)-3-ethoxy-3-oxoprop-1-enyl]cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135025625 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(Z)-3-ethoxy-3-oxoprop-1-enyl]cyclopropane-1,2-dicarboxylate |
| SMILES | CCOC(=O)/C=C\[C@H]1[C@H](C(=O)OCC)[C@]1(C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21NO8/c1-4-29-15(23)11-10-14-16(19(26)30-5-2)21(14,20(27)28-3)22-17(24)12-8-6-7-9-13(12)18(22)25/h6-11,14,16H,4-5H2,1-3H3/b11-10-/t14-,16+,21+/m0/s1 |
| InChIKey | PWXOQMIPICLERJ-NXMOSCISSA-N |
| XLogP | 1.12 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|