C15H18Cl5NO3 — CID 101126981
[3,5-dichloro-2-methoxy-6-(trichloromethyl)-4-pyridinyl] octanoate (PubChem CID 101126981) has the molecular formula C15H18Cl5NO3 and a molecular weight of 437.58 g/mol. Its IUPAC name is [3,5-dichloro-2-methoxy-6-(trichloromethyl)-4-pyridinyl] octanoate.
| Compound Name | [3,5-dichloro-2-methoxy-6-(trichloromethyl)-4-pyridinyl] octanoate |
|---|---|
| PubChem CID | 101126981 |
| Molecular Formula | C15H18Cl5NO3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | [3,5-dichloro-2-methoxy-6-(trichloromethyl)-4-pyridinyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1c(Cl)c(OC)nc(C(Cl)(Cl)Cl)c1Cl |
| InChI | InChI=1S/C15H18Cl5NO3/c1-3-4-5-6-7-8-9(22)24-12-10(16)13(15(18,19)20)21-14(23-2)11(12)17/h3-8H2,1-2H3 |
| InChIKey | VDBRPZWDUCXCRN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|