C23H22N4O2S — CID 10112744
(1R)-1-pyridin-3-yl-2-[2-[4-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol (PubChem CID 10112744) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is (1R)-1-pyridin-3-yl-2-[2-[4-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol.
| Compound Name | (1R)-1-pyridin-3-yl-2-[2-[4-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 10112744 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (1R)-1-pyridin-3-yl-2-[2-[4-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2csc(-c3ccncc3)n2)cc1)c1cccnc1 |
| InChI | InChI=1S/C23H22N4O2S/c28-22(19-2-1-9-25-14-19)15-26-12-13-29-20-5-3-17(4-6-20)21-16-30-23(27-21)18-7-10-24-11-8-18/h1-11,14,16,22,26,28H,12-13,15H2/t22-/m0/s1 |
| InChIKey | HCYMCYGSEHNSSU-QFIPXVFZSA-N |
| XLogP | 3.97 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|