C23H27N3O2S — CID 10136220
(1R)-2-[2-[4-(2-cyclopentyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol (PubChem CID 10136220) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is (1R)-2-[2-[4-(2-cyclopentyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol.
| Compound Name | (1R)-2-[2-[4-(2-cyclopentyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 10136220 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (1R)-2-[2-[4-(2-cyclopentyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2csc(C3CCCC3)n2)cc1)c1cccnc1 |
| InChI | InChI=1S/C23H27N3O2S/c27-22(19-6-3-11-24-14-19)15-25-12-13-28-20-9-7-17(8-10-20)21-16-29-23(26-21)18-4-1-2-5-18/h3,6-11,14,16,18,22,25,27H,1-2,4-5,12-13,15H2/t22-/m0/s1 |
| InChIKey | ISJPANQFRQXZLQ-QFIPXVFZSA-N |
| XLogP | 4.56 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|