C18H19N3O2S — CID 10291064
(1R)-1-pyridin-3-yl-2-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol (PubChem CID 10291064) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is (1R)-1-pyridin-3-yl-2-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol.
| Compound Name | (1R)-1-pyridin-3-yl-2-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 10291064 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (1R)-1-pyridin-3-yl-2-[2-[4-(1,3-thiazol-4-yl)phenoxy]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2cscn2)cc1)c1cccnc1 |
| InChI | InChI=1S/C18H19N3O2S/c22-18(15-2-1-7-19-10-15)11-20-8-9-23-16-5-3-14(4-6-16)17-12-24-13-21-17/h1-7,10,12-13,18,20,22H,8-9,11H2/t18-/m0/s1 |
| InChIKey | ZYUCOCQMSLRKPR-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|