C19H19BrN2O2S — CID 23647943
1-(4-bromothiophen-2-yl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylamino]ethanol (PubChem CID 23647943) has the molecular formula C19H19BrN2O2S and a molecular weight of 419.34 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylamino]ethanol.
| Compound Name | 1-(4-bromothiophen-2-yl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 23647943 |
| Molecular Formula | C19H19BrN2O2S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylamino]ethanol |
| SMILES | OC(CNCc1ccccc1OCc1ccccn1)c1cc(Br)cs1 |
| InChI | InChI=1S/C19H19BrN2O2S/c20-15-9-19(25-13-15)17(23)11-21-10-14-5-1-2-7-18(14)24-12-16-6-3-4-8-22-16/h1-9,13,17,21,23H,10-12H2 |
| InChIKey | OXXWZGNREZXHNZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |