C14H19N3O4 — CID 101128013
(2S,3R,4R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxan-4-ol (PubChem CID 101128013) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxan-4-ol.
| Compound Name | (2S,3R,4R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 101128013 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxan-4-ol |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O4/c1-9-11(16-17-15)12(18)13(14(19-2)21-9)20-8-10-6-4-3-5-7-10/h3-7,9,11-14,18H,8H2,1-2H3/t9-,11-,12-,13-,14+/m1/s1 |
| InChIKey | NJWFNXBLKYYKER-FZGMBXNASA-N |
| XLogP | 2.00 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|