C12H22FNO6 — CID 101128016
(2R)-N-[(2R,3R,4S,5R,6S)-4-fluoro-5,6-dimethoxy-2-methyloxan-3-yl]-2,4-dihydroxybutanamide (PubChem CID 101128016) has the molecular formula C12H22FNO6 and a molecular weight of 295.31 g/mol. Its IUPAC name is (2R)-N-[(2R,3R,4S,5R,6S)-4-fluoro-5,6-dimethoxy-2-methyloxan-3-yl]-2,4-dihydroxybutanamide.
| Compound Name | (2R)-N-[(2R,3R,4S,5R,6S)-4-fluoro-5,6-dimethoxy-2-methyloxan-3-yl]-2,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 101128016 |
| Molecular Formula | C12H22FNO6 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2R)-N-[(2R,3R,4S,5R,6S)-4-fluoro-5,6-dimethoxy-2-methyloxan-3-yl]-2,4-dihydroxybutanamide |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](NC(=O)[C@H](O)CCO)[C@H](F)[C@@H]1OC |
| InChI | InChI=1S/C12H22FNO6/c1-6-9(14-11(17)7(16)4-5-15)8(13)10(18-2)12(19-3)20-6/h6-10,12,15-16H,4-5H2,1-3H3,(H,14,17)/t6-,7-,8+,9-,10+,12+/m1/s1 |
| InChIKey | RNPSKHUETSEVSZ-DWOGUGJQSA-N |
| XLogP | -1.04 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |