C32H42O5SSi — CID 101128910
[(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol (PubChem CID 101128910) has the molecular formula C32H42O5SSi and a molecular weight of 566.84 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 101128910 |
| Molecular Formula | C32H42O5SSi |
| Molecular Weight | 566.84 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](CO)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C32H42O5SSi/c1-32(2,3)39(4,5)37-30-29(35-23-25-17-11-7-12-18-25)28(34-22-24-15-9-6-10-16-24)27(21-33)36-31(30)38-26-19-13-8-14-20-26/h6-20,27-31,33H,21-23H2,1-5H3/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | UBMNLFIERGIMNG-SAEUYMBFSA-N |
| XLogP | 7.06 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|