C33H62OSi3 — CID 101129919
[2-(2-adamantylidene)-3,4-ditert-butyl-1-[tert-butyl(dimethyl)silyl]oxysilet-1-yl]-tert-butyl-dimethylsilane (PubChem CID 101129919) has the molecular formula C33H62OSi3 and a molecular weight of 559.12 g/mol. Its IUPAC name is [2-(2-adamantylidene)-3,4-ditert-butyl-1-[tert-butyl(dimethyl)silyl]oxysilet-1-yl]-tert-butyl-dimethylsilane.
| Compound Name | [2-(2-adamantylidene)-3,4-ditert-butyl-1-[tert-butyl(dimethyl)silyl]oxysilet-1-yl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101129919 |
| Molecular Formula | C33H62OSi3 |
| Molecular Weight | 559.12 g/mol |
| Exact Mass | 558.41 |
| IUPAC Name | [2-(2-adamantylidene)-3,4-ditert-butyl-1-[tert-butyl(dimethyl)silyl]oxysilet-1-yl]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)[Si](O[Si](C)(C)C(C)(C)C)([Si](C)(C)C(C)(C)C)C1=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C33H62OSi3/c1-30(2,3)27-28(26-24-18-22-17-23(20-24)21-25(26)19-22)37(29(27)31(4,5)6,36(15,16)33(10,11)12)34-35(13,14)32(7,8)9/h22-25H,17-21H2,1-16H3/b28-26- |
| InChIKey | UMIPUEDDXGLWDZ-SGEDCAFJSA-N |
| XLogP | 10.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.12 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|