C21H27NO6 — CID 101133635
1-O-benzyl 2-O-methyl (2R,3S,4S)-3-[(2S)-2-hydroxy-2-[(2S)-oxiran-2-yl]ethyl]-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate (PubChem CID 101133635) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2R,3S,4S)-3-[(2S)-2-hydroxy-2-[(2S)-oxiran-2-yl]ethyl]-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2R,3S,4S)-3-[(2S)-2-hydroxy-2-[(2S)-oxiran-2-yl]ethyl]-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101133635 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2R,3S,4S)-3-[(2S)-2-hydroxy-2-[(2S)-oxiran-2-yl]ethyl]-4-prop-1-en-2-ylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(C)[C@H]1CN(C(=O)OCc2ccccc2)[C@@H](C(=O)OC)[C@H]1C[C@H](O)[C@@H]1CO1 |
| InChI | InChI=1S/C21H27NO6/c1-13(2)16-10-22(21(25)28-11-14-7-5-4-6-8-14)19(20(24)26-3)15(16)9-17(23)18-12-27-18/h4-8,15-19,23H,1,9-12H2,2-3H3/t15-,16+,17-,18-,19+/m0/s1 |
| InChIKey | XGUSFDCGDXYKFA-XCDZQEORSA-N |
| XLogP | 2.14 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|