C36H50O19 — CID 101133892
[(1R,3S,4S,5R,6R,19R,20S,21S,22R)-4,5,21,22-tetraacetyloxy-3-(phenylmethoxymethoxymethyl)-2,8,11,14,17,23,24-heptaoxatricyclo[17.3.1.13,6]tetracosan-20-yl] acetate (PubChem CID 101133892) has the molecular formula C36H50O19 and a molecular weight of 786.78 g/mol. Its IUPAC name is [(1R,3S,4S,5R,6R,19R,20S,21S,22R)-4,5,21,22-tetraacetyloxy-3-(phenylmethoxymethoxymethyl)-2,8,11,14,17,23,24-heptaoxatricyclo[17.3.1.13,6]tetracosan-20-yl] acetate.
| Compound Name | [(1R,3S,4S,5R,6R,19R,20S,21S,22R)-4,5,21,22-tetraacetyloxy-3-(phenylmethoxymethoxymethyl)-2,8,11,14,17,23,24-heptaoxatricyclo[17.3.1.13,6]tetracosan-20-yl] acetate |
|---|---|
| PubChem CID | 101133892 |
| Molecular Formula | C36H50O19 |
| Molecular Weight | 786.78 g/mol |
| Exact Mass | 786.29 |
| IUPAC Name | [(1R,3S,4S,5R,6R,19R,20S,21S,22R)-4,5,21,22-tetraacetyloxy-3-(phenylmethoxymethoxymethyl)-2,8,11,14,17,23,24-heptaoxatricyclo[17.3.1.13,6]tetracosan-20-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@H]2COCCOCCOCCOC[C@H]3O[C@@](COCOCc4ccccc4)(O[C@@H](O2)[C@@H]1OC(C)=O)[C@@H](OC(C)=O)[C@@H]3OC(C)=O |
| InChI | InChI=1S/C36H50O19/c1-22(37)48-30-28-18-44-15-13-42-11-12-43-14-16-45-19-29-31(49-23(2)38)34(52-26(5)41)36(54-29,20-47-21-46-17-27-9-7-6-8-10-27)55-35(53-28)33(51-25(4)40)32(30)50-24(3)39/h6-10,28-35H,11-21H2,1-5H3/t28-,29-,30+,31-,32+,33-,34+,35-,36+/m1/s1 |
| InChIKey | SHJKEIYVYKAJAU-ANOFQGSYSA-N |
| XLogP | 0.75 |
| TPSA | 214.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.78 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|