C17H20O3 — CID 101136309
methyl 4-[(3R)-3-hydroxy-3-tricyclo[4.2.1.01,4]nonanyl]benzoate (PubChem CID 101136309) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl 4-[(3R)-3-hydroxy-3-tricyclo[4.2.1.01,4]nonanyl]benzoate.
| Compound Name | methyl 4-[(3R)-3-hydroxy-3-tricyclo[4.2.1.01,4]nonanyl]benzoate |
|---|---|
| PubChem CID | 101136309 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl 4-[(3R)-3-hydroxy-3-tricyclo[4.2.1.01,4]nonanyl]benzoate |
| SMILES | COC(=O)c1ccc([C@@]2(O)CC34CCC(CC32)C4)cc1 |
| InChI | InChI=1S/C17H20O3/c1-20-15(18)12-2-4-13(5-3-12)17(19)10-16-7-6-11(9-16)8-14(16)17/h2-5,11,14,19H,6-10H2,1H3/t11?,14?,16?,17-/m0/s1 |
| InChIKey | QKHYMIZWZIBXHL-MJTTZUFASA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |