C33H34O3P2 — CID 101138992
[(1S)-1-[(3aS,5S,6S,6aR)-6-diphenylphosphanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-diphenylphosphane (PubChem CID 101138992) has the molecular formula C33H34O3P2 and a molecular weight of 540.58 g/mol. Its IUPAC name is [(1S)-1-[(3aS,5S,6S,6aR)-6-diphenylphosphanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-diphenylphosphane.
| Compound Name | [(1S)-1-[(3aS,5S,6S,6aR)-6-diphenylphosphanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101138992 |
| Molecular Formula | C33H34O3P2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [(1S)-1-[(3aS,5S,6S,6aR)-6-diphenylphosphanyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-diphenylphosphane |
| SMILES | C[C@@H]([C@@H]1O[C@H]2OC(C)(C)O[C@H]2[C@@H]1P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34O3P2/c1-24(37(25-16-8-4-9-17-25)26-18-10-5-11-19-26)29-31(30-32(34-29)36-33(2,3)35-30)38(27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-24,29-32H,1-3H3/t24-,29-,30-,31+,32-/m0/s1 |
| InChIKey | WKCVGTYNMPPOAI-DQFJKFGGSA-N |
| XLogP | 5.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|