C24H31IO4Si — CID 175402820
[(5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[tert-butyl(diphenyl)silyl]methanol (PubChem CID 175402820) has the molecular formula C24H31IO4Si and a molecular weight of 538.50 g/mol. Its IUPAC name is [(5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[tert-butyl(diphenyl)silyl]methanol.
| Compound Name | [(5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[tert-butyl(diphenyl)silyl]methanol |
|---|---|
| PubChem CID | 175402820 |
| Molecular Formula | C24H31IO4Si |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | [(5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[tert-butyl(diphenyl)silyl]methanol |
| SMILES | CC1(C)OC2O[C@H](C(O)[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](I)[C@H]2O1 |
| InChI | InChI=1S/C24H31IO4Si/c1-23(2,3)30(16-12-8-6-9-13-16,17-14-10-7-11-15-17)21(26)19-18(25)20-22(27-19)29-24(4,5)28-20/h6-15,18-22,26H,1-5H3/t18-,19+,20-,21?,22?/m1/s1 |
| InChIKey | ABOAOSPQZZGRFJ-PNLSILQLSA-N |
| XLogP | 3.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|