C28H35NO5Si — CID 134918188
4-[(3aR,5R,6S,6aS)-6-[tert-butyl(diphenyl)silyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]piperidine-2,6-dione (PubChem CID 134918188) has the molecular formula C28H35NO5Si and a molecular weight of 493.68 g/mol. Its IUPAC name is 4-[(3aR,5R,6S,6aS)-6-[tert-butyl(diphenyl)silyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]piperidine-2,6-dione.
| Compound Name | 4-[(3aR,5R,6S,6aS)-6-[tert-butyl(diphenyl)silyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134918188 |
| Molecular Formula | C28H35NO5Si |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 4-[(3aR,5R,6S,6aS)-6-[tert-butyl(diphenyl)silyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]piperidine-2,6-dione |
| SMILES | CC1(C)O[C@H]2O[C@H](C3CC(=O)NC(=O)C3)[C@H]([Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C28H35NO5Si/c1-27(2,3)35(19-12-8-6-9-13-19,20-14-10-7-11-15-20)25-23(18-16-21(30)29-22(31)17-18)32-26-24(25)33-28(4,5)34-26/h6-15,18,23-26H,16-17H2,1-5H3,(H,29,30,31)/t23-,24-,25+,26-/m1/s1 |
| InChIKey | QDMCUBLAJCPXDX-FXSWLTOZSA-N |
| XLogP | 3.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|