C28H37NO7 — CID 53355406
(2S,3R)-3-(dibenzylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propane-1,2-diol (PubChem CID 53355406) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is (2S,3R)-3-(dibenzylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propane-1,2-diol.
| Compound Name | (2S,3R)-3-(dibenzylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 53355406 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (2S,3R)-3-(dibenzylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propane-1,2-diol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@@H]([C@H](O)CO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H37NO7/c1-27(2)33-23-22(32-26-25(24(23)34-27)35-28(3,4)36-26)21(20(31)17-30)29(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14,20-26,30-31H,15-17H2,1-4H3/t20-,21-,22-,23+,24+,25-,26-/m1/s1 |
| InChIKey | CCVOYEYFZFEIPC-NHQGBICISA-N |
| XLogP | 2.81 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |