C29H38ClNO6 — CID 11145873
(1R,2S)-N,N-dibenzyl-3-chloro-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine (PubChem CID 11145873) has the molecular formula C29H38ClNO6 and a molecular weight of 532.08 g/mol. Its IUPAC name is (1R,2S)-N,N-dibenzyl-3-chloro-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine.
| Compound Name | (1R,2S)-N,N-dibenzyl-3-chloro-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine |
|---|---|
| PubChem CID | 11145873 |
| Molecular Formula | C29H38ClNO6 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | (1R,2S)-N,N-dibenzyl-3-chloro-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine |
| SMILES | CO[C@H](CCl)[C@@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H38ClNO6/c1-28(2)34-24-23(33-27-26(25(24)35-28)36-29(3,4)37-27)22(21(16-30)32-5)31(17-19-12-8-6-9-13-19)18-20-14-10-7-11-15-20/h6-15,21-27H,16-18H2,1-5H3/t21-,22+,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | USFRGNJRSVCVTI-LBLAFIJZSA-N |
| XLogP | 4.71 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|