C25H31NO8 — CID 10814344
[benzyl-[(R)-furan-2-yl-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]amino] acetate (PubChem CID 10814344) has the molecular formula C25H31NO8 and a molecular weight of 473.52 g/mol. Its IUPAC name is [benzyl-[(R)-furan-2-yl-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]amino] acetate.
| Compound Name | [benzyl-[(R)-furan-2-yl-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]amino] acetate |
|---|---|
| PubChem CID | 10814344 |
| Molecular Formula | C25H31NO8 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [benzyl-[(R)-furan-2-yl-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]amino] acetate |
| SMILES | CC(=O)ON(Cc1ccccc1)[C@@H](c1ccco1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C25H31NO8/c1-15(27)34-26(14-16-10-7-6-8-11-16)18(17-12-9-13-28-17)19-20-21(31-24(2,3)30-20)22-23(29-19)33-25(4,5)32-22/h6-13,18-23H,14H2,1-5H3/t18-,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | AGXGJTBHXVIFKW-BRXKOZLESA-N |
| XLogP | 3.70 |
| TPSA | 88.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|