C30H26NO5+ — CID 101144155
[9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium-10-yl]-phenylmethanone (PubChem CID 101144155) has the molecular formula C30H26NO5+ and a molecular weight of 480.54 g/mol. Its IUPAC name is [9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium-10-yl]-phenylmethanone.
| Compound Name | [9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium-10-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101144155 |
| Molecular Formula | C30H26NO5+ |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium-10-yl]-phenylmethanone |
| SMILES | COc1cccc(OC)c1-c1c2c(OC)cccc2[n+](C(=O)c2ccccc2)c2cccc(OC)c12 |
| InChI | InChI=1S/C30H26NO5/c1-33-22-15-8-13-20-26(22)29(28-24(35-3)17-10-18-25(28)36-4)27-21(14-9-16-23(27)34-2)31(20)30(32)19-11-6-5-7-12-19/h5-18H,1-4H3/q+1 |
| InChIKey | VMLXZORUZPOPHA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|