C30H28NO4+ — CID 11261394
10-benzyl-9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium (PubChem CID 11261394) has the molecular formula C30H28NO4+ and a molecular weight of 466.56 g/mol. Its IUPAC name is 10-benzyl-9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium.
| Compound Name | 10-benzyl-9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium |
|---|---|
| PubChem CID | 11261394 |
| Molecular Formula | C30H28NO4+ |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 10-benzyl-9-(2,6-dimethoxyphenyl)-1,8-dimethoxyacridin-10-ium |
| SMILES | COc1cccc(OC)c1-c1c2c(OC)cccc2[n+](Cc2ccccc2)c2cccc(OC)c12 |
| InChI | InChI=1S/C30H28NO4/c1-32-23-15-8-13-21-27(23)30(29-25(34-3)17-10-18-26(29)35-4)28-22(14-9-16-24(28)33-2)31(21)19-20-11-6-5-7-12-20/h5-18H,19H2,1-4H3/q+1 |
| InChIKey | YKEMCIJEOMGPBS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|