C29H35N4O2+ — CID 123839384
3-[3,19-dimethoxy-14-[3-(methylamino)propyl]-8-aza-14-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-8-yl]-N-methylpropan-1-amine (PubChem CID 123839384) has the molecular formula C29H35N4O2+ and a molecular weight of 471.63 g/mol. Its IUPAC name is 3-[3,19-dimethoxy-14-[3-(methylamino)propyl]-8-aza-14-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-8-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[3,19-dimethoxy-14-[3-(methylamino)propyl]-8-aza-14-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-8-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 123839384 |
| Molecular Formula | C29H35N4O2+ |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 3-[3,19-dimethoxy-14-[3-(methylamino)propyl]-8-aza-14-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-8-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1c2cccc(OC)c2-c2c3c(OC)cccc3[n+](CCCNC)c3cccc1c23 |
| InChI | InChI=1S/C29H35N4O2/c1-30-16-8-18-32-20-10-5-11-21-26(20)29(27-22(32)12-6-14-24(27)34-3)28-23(13-7-15-25(28)35-4)33(21)19-9-17-31-2/h5-7,10-15,30-31H,8-9,16-19H2,1-4H3/q+1 |
| InChIKey | HGIGZQJABWFNTA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|