C17H29F3O3Si — CID 101145135
2,2,2-trifluoroethyl (1S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-7-carboxylate (PubChem CID 101145135) has the molecular formula C17H29F3O3Si and a molecular weight of 366.50 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-7-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-7-carboxylate |
|---|---|
| PubChem CID | 101145135 |
| Molecular Formula | C17H29F3O3Si |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2,2,2-trifluoroethyl (1S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-7-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CCCC[C@H]1C[C@H]2C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C17H29F3O3Si/c1-15(2,3)24(4,5)23-16-9-7-6-8-12(16)10-13(16)14(21)22-11-17(18,19)20/h12-13H,6-11H2,1-5H3/t12-,13-,16+/m0/s1 |
| InChIKey | BXKDKZFQGXJDTH-HEHGZKQESA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|