C20H35F3O3Si — CID 101441844
2,2,2-trifluoroethyl (1S,6R,7R)-6-tri(propan-2-yl)silyloxybicyclo[4.2.0]octane-7-carboxylate (PubChem CID 101441844) has the molecular formula C20H35F3O3Si and a molecular weight of 408.58 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1S,6R,7R)-6-tri(propan-2-yl)silyloxybicyclo[4.2.0]octane-7-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1S,6R,7R)-6-tri(propan-2-yl)silyloxybicyclo[4.2.0]octane-7-carboxylate |
|---|---|
| PubChem CID | 101441844 |
| Molecular Formula | C20H35F3O3Si |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2,2,2-trifluoroethyl (1S,6R,7R)-6-tri(propan-2-yl)silyloxybicyclo[4.2.0]octane-7-carboxylate |
| SMILES | CC(C)[Si](O[C@]12CCCC[C@H]1C[C@H]2C(=O)OCC(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H35F3O3Si/c1-13(2)27(14(3)4,15(5)6)26-19-10-8-7-9-16(19)11-17(19)18(24)25-12-20(21,22)23/h13-17H,7-12H2,1-6H3/t16-,17-,19+/m0/s1 |
| InChIKey | JOLMAKMXLOOIIS-JENIJYKNSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|