C19H30F6O3Si — CID 11259427
1,1,1,3,3,3-hexafluoropropan-2-yl (1S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-7-carboxylate (PubChem CID 11259427) has the molecular formula C19H30F6O3Si and a molecular weight of 448.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-7-carboxylate |
|---|---|
| PubChem CID | 11259427 |
| Molecular Formula | C19H30F6O3Si |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-7-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CCCC[C@@]1(C)C[C@H]2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H30F6O3Si/c1-15(2,3)29(5,6)28-17-10-8-7-9-16(17,4)11-12(17)13(26)27-14(18(20,21)22)19(23,24)25/h12,14H,7-11H2,1-6H3/t12-,16-,17-/m0/s1 |
| InChIKey | KEOOARUWUOZHJF-ZLIFDBKOSA-N |
| XLogP | 6.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|