C20H32F6O3Si — CID 101371471
1,1,1,3,3,3-hexafluoropropan-2-yl (1S,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxybicyclo[6.2.0]decane-9-carboxylate (PubChem CID 101371471) has the molecular formula C20H32F6O3Si and a molecular weight of 462.55 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxybicyclo[6.2.0]decane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxybicyclo[6.2.0]decane-9-carboxylate |
|---|---|
| PubChem CID | 101371471 |
| Molecular Formula | C20H32F6O3Si |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxybicyclo[6.2.0]decane-9-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CCCCCC[C@H]1C[C@@H]2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H32F6O3Si/c1-17(2,3)30(4,5)29-18-11-9-7-6-8-10-13(18)12-14(18)15(27)28-16(19(21,22)23)20(24,25)26/h13-14,16H,6-12H2,1-5H3/t13-,14+,18+/m0/s1 |
| InChIKey | PSTGSZCIPMZONY-PMUMKWKESA-N |
| XLogP | 6.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|