C23H10BrFN4S2 — CID 101148371
2-[5-[1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 101148371) has the molecular formula C23H10BrFN4S2 and a molecular weight of 505.40 g/mol. Its IUPAC name is 2-[5-[1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-[1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 101148371 |
| Molecular Formula | C23H10BrFN4S2 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | 2-[5-[1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(-c2ccc(-c3cccs3)n2-c2ccc(F)cc2Br)s1 |
| InChI | InChI=1S/C23H10BrFN4S2/c24-17-10-15(25)3-4-18(17)29-19(22-2-1-9-30-22)5-6-20(29)23-8-7-21(31-23)16(13-28)14(11-26)12-27/h1-10H |
| InChIKey | UGCCGSATBWCORE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|