C27H20N4S2 — CID 22111933
2-[5-[1-(4-butylphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 22111933) has the molecular formula C27H20N4S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is 2-[5-[1-(4-butylphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-[1-(4-butylphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 22111933 |
| Molecular Formula | C27H20N4S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[5-[1-(4-butylphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CCCCc1ccc(-n2c(-c3cccs3)ccc2-c2ccc(C(C#N)=C(C#N)C#N)s2)cc1 |
| InChI | InChI=1S/C27H20N4S2/c1-2-3-5-19-7-9-21(10-8-19)31-23(26-6-4-15-32-26)11-12-24(31)27-14-13-25(33-27)22(18-30)20(16-28)17-29/h4,6-15H,2-3,5H2,1H3 |
| InChIKey | KAACHCMPZKQDJO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|