C27H24N4S2 — CID 122449507
2-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 122449507) has the molecular formula C27H24N4S2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 2-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 122449507 |
| Molecular Formula | C27H24N4S2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CC(C)(C)c1cc(-n2c3ccsc3c3sc(C(C#N)=C(C#N)C#N)cc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H24N4S2/c1-26(2,3)17-9-18(27(4,5)6)11-19(10-17)31-21-7-8-32-24(21)25-22(31)12-23(33-25)20(15-30)16(13-28)14-29/h7-12H,1-6H3 |
| InChIKey | LITFKBKJGQMUOM-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|