C35H28N4OS — CID 137476819
2-[6-(3,6-ditert-butylcarbazol-9-yl)thieno[3,2-b][1]benzofuran-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 137476819) has the molecular formula C35H28N4OS and a molecular weight of 552.70 g/mol. Its IUPAC name is 2-[6-(3,6-ditert-butylcarbazol-9-yl)thieno[3,2-b][1]benzofuran-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[6-(3,6-ditert-butylcarbazol-9-yl)thieno[3,2-b][1]benzofuran-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 137476819 |
| Molecular Formula | C35H28N4OS |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2-[6-(3,6-ditert-butylcarbazol-9-yl)thieno[3,2-b][1]benzofuran-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc2c(c1)oc1cc(C(C#N)=C(C#N)C#N)sc12 |
| InChI | InChI=1S/C35H28N4OS/c1-34(2,3)21-7-11-28-25(13-21)26-14-22(35(4,5)6)8-12-29(26)39(28)23-9-10-24-30(15-23)40-31-16-32(41-33(24)31)27(19-38)20(17-36)18-37/h7-16H,1-6H3 |
| InChIKey | QOGRSNMLPANPEX-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 89.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|