C46H37N3 — CID 102283444
2-[[4-[2-[4-[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methylidene]propanedinitrile (PubChem CID 102283444) has the molecular formula C46H37N3 and a molecular weight of 631.82 g/mol. Its IUPAC name is 2-[[4-[2-[4-[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[2-[4-[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102283444 |
| Molecular Formula | C46H37N3 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | 2-[[4-[2-[4-[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methylidene]propanedinitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(C#Cc2ccc(C#Cc3ccc(C=C(C#N)C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H37N3/c1-45(2,3)38-21-25-43-41(28-38)42-29-39(46(4,5)6)22-26-44(42)49(43)40-23-19-35(20-24-40)14-13-33-9-7-32(8-10-33)11-12-34-15-17-36(18-16-34)27-37(30-47)31-48/h7-10,15-29H,1-6H3 |
| InChIKey | XNMKSEDKUYGJJO-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|