C29H32N2O2 — CID 177493893
[(E)-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]methylideneamino] acetate (PubChem CID 177493893) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [(E)-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]methylideneamino] acetate.
| Compound Name | [(E)-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]methylideneamino] acetate |
|---|---|
| PubChem CID | 177493893 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [(E)-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]methylideneamino] acetate |
| SMILES | CC(=O)O/N=C/c1ccc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C29H32N2O2/c1-19(32)33-30-18-20-8-12-23(13-9-20)31-26-14-10-21(28(2,3)4)16-24(26)25-17-22(29(5,6)7)11-15-27(25)31/h8-18H,1-7H3/b30-18+ |
| InChIKey | AFLVLGWFZIWYKG-UXHLAJHPSA-N |
| XLogP | 7.28 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|