C69H62N2O — CID 44518592
2,7-bis[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]fluoren-9-one (PubChem CID 44518592) has the molecular formula C69H62N2O and a molecular weight of 935.27 g/mol. Its IUPAC name is 2,7-bis[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]fluoren-9-one.
| Compound Name | 2,7-bis[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]fluoren-9-one |
|---|---|
| PubChem CID | 44518592 |
| Molecular Formula | C69H62N2O |
| Molecular Weight | 935.27 g/mol |
| Exact Mass | 934.49 |
| IUPAC Name | 2,7-bis[2-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]ethynyl]fluoren-9-one |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(C#Cc2ccc3c(c2)C(=O)c2cc(C#Cc4ccc(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C69H62N2O/c1-66(2,3)47-23-33-61-55(39-47)56-40-48(67(4,5)6)24-34-62(56)70(61)51-27-17-43(18-28-51)13-15-45-21-31-53-54-32-22-46(38-60(54)65(72)59(53)37-45)16-14-44-19-29-52(30-20-44)71-63-35-25-49(68(7,8)9)41-57(63)58-42-50(69(10,11)12)26-36-64(58)71/h17-42H,1-12H3 |
| InChIKey | CQPXCWUCUPLMTA-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.27 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|