C31H25Cl2N3O2 — CID 101149581
1-[(4-tert-butylphenyl)methyl]-3,4-bis(7-chloro-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 101149581) has the molecular formula C31H25Cl2N3O2 and a molecular weight of 542.47 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3,4-bis(7-chloro-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3,4-bis(7-chloro-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 101149581 |
| Molecular Formula | C31H25Cl2N3O2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3,4-bis(7-chloro-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)c1ccc(CN2C(=O)C(c3c[nH]c4c(Cl)cccc34)=C(c3c[nH]c4c(Cl)cccc34)C2=O)cc1 |
| InChI | InChI=1S/C31H25Cl2N3O2/c1-31(2,3)18-12-10-17(11-13-18)16-36-29(37)25(21-14-34-27-19(21)6-4-8-23(27)32)26(30(36)38)22-15-35-28-20(22)7-5-9-24(28)33/h4-15,34-35H,16H2,1-3H3 |
| InChIKey | FXVHALDDRZEJTE-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|