C22H36O3 — CID 101150011
[(1R,3aS,9E,12Z)-1-[2-(methoxymethoxy)propan-2-yl]-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-10-yl]methanol (PubChem CID 101150011) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is [(1R,3aS,9E,12Z)-1-[2-(methoxymethoxy)propan-2-yl]-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-10-yl]methanol.
| Compound Name | [(1R,3aS,9E,12Z)-1-[2-(methoxymethoxy)propan-2-yl]-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-10-yl]methanol |
|---|---|
| PubChem CID | 101150011 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | [(1R,3aS,9E,12Z)-1-[2-(methoxymethoxy)propan-2-yl]-3a-methyl-6-methylidene-1,2,3,4,5,7,8,11-octahydrocyclopenta[11]annulen-10-yl]methanol |
| SMILES | C=C1CC/C=C(/CO)C/C=C2/[C@H](C(C)(C)OCOC)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H36O3/c1-17-7-6-8-18(15-23)9-10-20-19(21(2,3)25-16-24-5)12-14-22(20,4)13-11-17/h8,10,19,23H,1,6-7,9,11-16H2,2-5H3/b18-8+,20-10-/t19-,22-/m1/s1 |
| InChIKey | AVVIYVIDEDPIIN-JOZZZXPMSA-N |
| XLogP | 5.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|