C16H24O3 — CID 101153102
(1R)-1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]-1-phenylethanol (PubChem CID 101153102) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R)-1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]-1-phenylethanol.
| Compound Name | (1R)-1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 101153102 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R)-1-[(2R,4R)-4-tert-butyl-1,3-dioxan-2-yl]-1-phenylethanol |
| SMILES | CC(C)(C)[C@H]1CCO[C@@H]([C@](C)(O)c2ccccc2)O1 |
| InChI | InChI=1S/C16H24O3/c1-15(2,3)13-10-11-18-14(19-13)16(4,17)12-8-6-5-7-9-12/h5-9,13-14,17H,10-11H2,1-4H3/t13-,14-,16-/m1/s1 |
| InChIKey | NMEDGSGNQBAJLI-IIAWOOMASA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |