C15H8O4S — CID 101153318
2,2-dihydroxyindeno[5,4-b][1]benzothiole-1,3-dione (PubChem CID 101153318) has the molecular formula C15H8O4S and a molecular weight of 284.29 g/mol. Its IUPAC name is 2,2-dihydroxyindeno[5,4-b][1]benzothiole-1,3-dione.
| Compound Name | 2,2-dihydroxyindeno[5,4-b][1]benzothiole-1,3-dione |
|---|---|
| PubChem CID | 101153318 |
| Molecular Formula | C15H8O4S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 2,2-dihydroxyindeno[5,4-b][1]benzothiole-1,3-dione |
| SMILES | O=C1c2ccc3sc4ccccc4c3c2C(=O)C1(O)O |
| InChI | InChI=1S/C15H8O4S/c16-13-8-5-6-10-11(12(8)14(17)15(13,18)19)7-3-1-2-4-9(7)20-10/h1-6,18-19H |
| InChIKey | HPDCFDGTDBPILQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|