C61H81F3N6O10 — CID 101153644
bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[pteridin-6-ylmethyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate (PubChem CID 101153644) has the molecular formula C61H81F3N6O10 and a molecular weight of 1115.34 g/mol. Its IUPAC name is bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[pteridin-6-ylmethyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[pteridin-6-ylmethyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 101153644 |
| Molecular Formula | C61H81F3N6O10 |
| Molecular Weight | 1115.34 g/mol |
| Exact Mass | 1114.60 |
| IUPAC Name | bis[2-(3,4-dihexoxyphenyl)ethyl] (2S)-2-[[4-[pteridin-6-ylmethyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CCCCCCOc1ccc(CCOC(=O)CC[C@H](NC(=O)c2ccc(N(Cc3cnc4ncncc4n3)C(=O)C(F)(F)F)cc2)C(=O)OCCc2ccc(OCCCCCC)c(OCCCCCC)c2)cc1OCCCCCC |
| InChI | InChI=1S/C61H81F3N6O10/c1-5-9-13-17-33-75-52-28-21-45(39-54(52)77-35-19-15-11-7-3)31-37-79-56(71)30-27-50(59(73)80-38-32-46-22-29-53(76-34-18-14-10-6-2)55(40-46)78-36-20-16-12-8-4)69-58(72)47-23-25-49(26-24-47)70(60(74)61(62,63)64)43-48-41-66-57-51(68-48)42-65-44-67-57/h21-26,28-29,39-42,44,50H,5-20,27,30-38,43H2,1-4H3,(H,69,72)/t50-/m0/s1 |
| InChIKey | RLONRWMLJMVSSX-DPDRHGIRSA-N |
| XLogP | 12.80 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.34 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|