C27H32N6O8 — CID 162649548
2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]pentanedioic acid (PubChem CID 162649548) has the molecular formula C27H32N6O8 and a molecular weight of 568.59 g/mol. Its IUPAC name is 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 162649548 |
| Molecular Formula | C27H32N6O8 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]pentanedioic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCNc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H32N6O8/c1-39-20-12-15(11-17-14-31-27(29)33-24(17)28)13-21(40-2)23(20)41-10-9-30-18-5-3-16(4-6-18)25(36)32-19(26(37)38)7-8-22(34)35/h3-6,12-14,19,30H,7-11H2,1-2H3,(H,32,36)(H,34,35)(H,37,38)(H4,28,29,31,33) |
| InChIKey | CTNBRSFEBYDJGE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 221.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|