C11H13BrO2S — CID 101153746
(1S,2S,5R)-2-[(Z)-2-bromobut-2-enoyl]-8-thiabicyclo[3.2.1]octan-3-one (PubChem CID 101153746) has the molecular formula C11H13BrO2S and a molecular weight of 289.19 g/mol. Its IUPAC name is (1S,2S,5R)-2-[(Z)-2-bromobut-2-enoyl]-8-thiabicyclo[3.2.1]octan-3-one.
| Compound Name | (1S,2S,5R)-2-[(Z)-2-bromobut-2-enoyl]-8-thiabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 101153746 |
| Molecular Formula | C11H13BrO2S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | (1S,2S,5R)-2-[(Z)-2-bromobut-2-enoyl]-8-thiabicyclo[3.2.1]octan-3-one |
| SMILES | C/C=C(\Br)C(=O)[C@@H]1C(=O)C[C@H]2CC[C@@H]1S2 |
| InChI | InChI=1S/C11H13BrO2S/c1-2-7(12)11(14)10-8(13)5-6-3-4-9(10)15-6/h2,6,9-10H,3-5H2,1H3/b7-2-/t6-,9+,10-/m1/s1 |
| InChIKey | OINZTMWMUPEQMN-TUKLPEKNSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|